C6H9F3N2 — CID 155751639
(Z)-4,4,4-trifluoro-2-methyl-3-methyliminobut-1-en-1-amine (PubChem CID 155751639) has the molecular formula C6H9F3N2 and a molecular weight of 166.15 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-2-methyl-3-methyliminobut-1-en-1-amine.
| Compound Name | (Z)-4,4,4-trifluoro-2-methyl-3-methyliminobut-1-en-1-amine |
|---|---|
| PubChem CID | 155751639 |
| Molecular Formula | C6H9F3N2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (Z)-4,4,4-trifluoro-2-methyl-3-methyliminobut-1-en-1-amine |
| SMILES | C/N=C(C(/C)=C\N)\C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2/c1-4(3-10)5(11-2)6(7,8)9/h3H,10H2,1-2H3/b4-3-,11-5- |
| InChIKey | RZQTWRYQLQKWOI-RUTRJIIFSA-N |
| XLogP | 1.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|