C17H15F3N2O2S — CID 155760957
(1R,2S,4R)-2-methyl-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 155760957) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is (1R,2S,4R)-2-methyl-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4R)-2-methyl-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 155760957 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (1R,2S,4R)-2-methyl-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C[C@]1(C(=O)Nc2nc3ccc(OC(F)(F)F)cc3s2)C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H15F3N2O2S/c1-16(8-9-2-3-10(16)6-9)14(23)22-15-21-12-5-4-11(7-13(12)25-15)24-17(18,19)20/h2-5,7,9-10H,6,8H2,1H3,(H,21,22,23)/t9-,10+,16+/m1/s1 |
| InChIKey | NJVYVCXEDURROY-LSYCYVAJSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|