C21H12Cl2N2O2 — CID 155762078
7-chloro-9-[(4-chlorophenyl)methyl]-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione (PubChem CID 155762078) has the molecular formula C21H12Cl2N2O2 and a molecular weight of 395.25 g/mol. Its IUPAC name is 7-chloro-9-[(4-chlorophenyl)methyl]-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione.
| Compound Name | 7-chloro-9-[(4-chlorophenyl)methyl]-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione |
|---|---|
| PubChem CID | 155762078 |
| Molecular Formula | C21H12Cl2N2O2 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 7-chloro-9-[(4-chlorophenyl)methyl]-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione |
| SMILES | O=C1c2c(n(Cc3ccc(Cl)cc3)c3c(Cl)cccc3c2=O)-c2cccn21 |
| InChI | InChI=1S/C21H12Cl2N2O2/c22-13-8-6-12(7-9-13)11-25-18-14(3-1-4-15(18)23)20(26)17-19(25)16-5-2-10-24(16)21(17)27/h1-10H,11H2 |
| InChIKey | WAKZNEBSWVEWPC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |