C28H17N3O2 — CID 155762150
2-[[4-(2-isocyanophenyl)phenyl]methyl]-2,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-9,16-dione (PubChem CID 155762150) has the molecular formula C28H17N3O2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[[4-(2-isocyanophenyl)phenyl]methyl]-2,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-9,16-dione.
| Compound Name | 2-[[4-(2-isocyanophenyl)phenyl]methyl]-2,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-9,16-dione |
|---|---|
| PubChem CID | 155762150 |
| Molecular Formula | C28H17N3O2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[4-(2-isocyanophenyl)phenyl]methyl]-2,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-9,16-dione |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(Cn2c3c(c(=O)c4ccccc42)-c2cccn2C3=O)cc1 |
| InChI | InChI=1S/C28H17N3O2/c1-29-22-9-4-2-7-20(22)19-14-12-18(13-15-19)17-31-23-10-5-3-8-21(23)27(32)25-24-11-6-16-30(24)28(33)26(25)31/h2-16H,17H2 |
| InChIKey | VNFSXTVQPNKOMN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 48.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|