C20H24BNO4 — CID 155763622
6-(2-bicyclo[3.1.1]heptanylmethyl)-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 155763622) has the molecular formula C20H24BNO4 and a molecular weight of 353.23 g/mol. Its IUPAC name is 6-(2-bicyclo[3.1.1]heptanylmethyl)-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-(2-bicyclo[3.1.1]heptanylmethyl)-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 155763622 |
| Molecular Formula | C20H24BNO4 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 6-(2-bicyclo[3.1.1]heptanylmethyl)-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | O=C1CN(CC2CCC3CC2C3)CC(=O)OB(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C20H24BNO4/c23-19-13-22(12-17-7-6-16-10-18(17)11-16)14-20(24)26-21(25-19)9-8-15-4-2-1-3-5-15/h1-5,8-9,16-18H,6-7,10-14H2/b9-8+ |
| InChIKey | GEVQQHFRDJIQQE-CMDGGOBGSA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|