C14H16BNO4 — CID 162411542
6-methyl-2-[(E)-2-(2-methylphenyl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 162411542) has the molecular formula C14H16BNO4 and a molecular weight of 273.10 g/mol. Its IUPAC name is 6-methyl-2-[(E)-2-(2-methylphenyl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[(E)-2-(2-methylphenyl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 162411542 |
| Molecular Formula | C14H16BNO4 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 6-methyl-2-[(E)-2-(2-methylphenyl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1ccccc1/C=C/B1OC(=O)CN(C)CC(=O)O1 |
| InChI | InChI=1S/C14H16BNO4/c1-11-5-3-4-6-12(11)7-8-15-19-13(17)9-16(2)10-14(18)20-15/h3-8H,9-10H2,1-2H3/b8-7+ |
| InChIKey | JKSQOEHASVHCKT-BQYQJAHWSA-N |
| XLogP | 1.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|