C36H20N2O4S2 — CID 155766692
(2E)-2-[(12E)-2,9-bis(benzenesulfonyl)-12-(cyanomethylidene)indeno[2,1-a]fluoren-11-ylidene]acetonitrile (PubChem CID 155766692) has the molecular formula C36H20N2O4S2 and a molecular weight of 608.70 g/mol. Its IUPAC name is (2E)-2-[(12E)-2,9-bis(benzenesulfonyl)-12-(cyanomethylidene)indeno[2,1-a]fluoren-11-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(12E)-2,9-bis(benzenesulfonyl)-12-(cyanomethylidene)indeno[2,1-a]fluoren-11-ylidene]acetonitrile |
|---|---|
| PubChem CID | 155766692 |
| Molecular Formula | C36H20N2O4S2 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | (2E)-2-[(12E)-2,9-bis(benzenesulfonyl)-12-(cyanomethylidene)indeno[2,1-a]fluoren-11-ylidene]acetonitrile |
| SMILES | N#C/C=C1\c2cc(S(=O)(=O)c3ccccc3)ccc2-c2ccc3c(c21)/C(=C/C#N)c1cc(S(=O)(=O)c2ccccc2)ccc1-3 |
| InChI | InChI=1S/C36H20N2O4S2/c37-19-17-31-33-21-25(43(39,40)23-7-3-1-4-8-23)11-13-27(33)29-15-16-30-28-14-12-26(44(41,42)24-9-5-2-6-10-24)22-34(28)32(18-20-38)36(30)35(29)31/h1-18,21-22H/b31-17+,32-18+ |
| InChIKey | QBEVIOIKLYEHNI-LTTYKRRRSA-N |
| XLogP | 7.22 |
| TPSA | 115.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|