C11H9NSe — CID 155771410
4-methylselenopheno[2,3-b]indole (PubChem CID 155771410) has the molecular formula C11H9NSe and a molecular weight of 234.16 g/mol. Its IUPAC name is 4-methylselenopheno[2,3-b]indole.
| Compound Name | 4-methylselenopheno[2,3-b]indole |
|---|---|
| PubChem CID | 155771410 |
| Molecular Formula | C11H9NSe |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 4-methylselenopheno[2,3-b]indole |
| SMILES | Cn1c2ccccc2c2cc[se]c21 |
| InChI | InChI=1S/C11H9NSe/c1-12-10-5-3-2-4-8(10)9-6-7-13-11(9)12/h2-7H,1H3 |
| InChIKey | NWQJZNNCRFREAJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|