C18H29BrN2O — CID 155773846
benzyl-diethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium bromide (PubChem CID 155773846) has the molecular formula C18H29BrN2O and a molecular weight of 369.35 g/mol. Its IUPAC name is benzyl-diethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium bromide.
| Compound Name | benzyl-diethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium bromide |
|---|---|
| PubChem CID | 155773846 |
| Molecular Formula | C18H29BrN2O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | benzyl-diethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium bromide |
| SMILES | C=C(C)C(=O)NCCC[N+](CC)(CC)Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C18H28N2O.BrH/c1-5-20(6-2,15-17-11-8-7-9-12-17)14-10-13-19-18(21)16(3)4;/h7-9,11-12H,3,5-6,10,13-15H2,1-2,4H3;1H |
| InChIKey | RMWLXIYORSMHPR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|