C22H24FNO4 — CID 155775303
methyl (2R)-1-[2-(4-fluorophenyl)acetyl]-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate (PubChem CID 155775303) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl (2R)-1-[2-(4-fluorophenyl)acetyl]-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2-(4-fluorophenyl)acetyl]-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 155775303 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl (2R)-1-[2-(4-fluorophenyl)acetyl]-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@]1(COCc2ccccc2)CCCN1C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FNO4/c1-27-21(26)22(16-28-15-18-6-3-2-4-7-18)12-5-13-24(22)20(25)14-17-8-10-19(23)11-9-17/h2-4,6-11H,5,12-16H2,1H3/t22-/m1/s1 |
| InChIKey | YELBTYXQSJKINW-JOCHJYFZSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |