C18H24N2O5 — CID 67272370
methyl (2S)-2-ethyl-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate (PubChem CID 67272370) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl (2S)-2-ethyl-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-2-ethyl-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67272370 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl (2S)-2-ethyl-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CC[C@@]1(C(=O)OC)CCCN1C(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O5/c1-3-18(16(22)24-2)10-7-11-20(18)15(21)12-19-17(23)25-13-14-8-5-4-6-9-14/h4-6,8-9H,3,7,10-13H2,1-2H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | VLOQBTIXTOWCNC-SFHVURJKSA-N |
| XLogP | 1.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |