C23H29N3O8 — CID 67272530
(2S)-2-[[(2R)-1-[2-(phenylmethoxycarbonylamino)acetyl]-2-prop-2-enylpyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 67272530) has the molecular formula C23H29N3O8 and a molecular weight of 475.50 g/mol. Its IUPAC name is (2S)-2-[[(2R)-1-[2-(phenylmethoxycarbonylamino)acetyl]-2-prop-2-enylpyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-1-[2-(phenylmethoxycarbonylamino)acetyl]-2-prop-2-enylpyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 67272530 |
| Molecular Formula | C23H29N3O8 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (2S)-2-[[(2R)-1-[2-(phenylmethoxycarbonylamino)acetyl]-2-prop-2-enylpyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | C=CC[C@@]1(C(=O)N[C@@H](CCC(=O)O)C(=O)O)CCCN1C(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O8/c1-2-11-23(21(32)25-17(20(30)31)9-10-19(28)29)12-6-13-26(23)18(27)14-24-22(33)34-15-16-7-4-3-5-8-16/h2-5,7-8,17H,1,6,9-15H2,(H,24,33)(H,25,32)(H,28,29)(H,30,31)/t17-,23-/m0/s1 |
| InChIKey | UWDAEKKFLJPCQS-SBUREZEXSA-N |
| XLogP | 1.28 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|