C19H26N2O5 — CID 154295124
methyl 1-amino-2-methyl-2-[2-(phenylmethoxycarbonylamino)acetyl]cyclohexane-1-carboxylate (PubChem CID 154295124) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 1-amino-2-methyl-2-[2-(phenylmethoxycarbonylamino)acetyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-2-methyl-2-[2-(phenylmethoxycarbonylamino)acetyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154295124 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl 1-amino-2-methyl-2-[2-(phenylmethoxycarbonylamino)acetyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCCC1(C)C(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5/c1-18(10-6-7-11-19(18,20)16(23)25-2)15(22)12-21-17(24)26-13-14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13,20H2,1-2H3,(H,21,24) |
| InChIKey | IYZUIVYWMXEZGZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |