C17H23N2O5+ — CID 57050017
(2R)-1,2-dimethyl-2-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57050017) has the molecular formula C17H23N2O5+ and a molecular weight of 335.38 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-2-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1,2-dimethyl-2-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57050017 |
| Molecular Formula | C17H23N2O5+ |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2R)-1,2-dimethyl-2-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@]1(C(=O)CNC(=O)OCc2ccccc2)CCC[N+]1(C)C(=O)O |
| InChI | InChI=1S/C17H22N2O5/c1-17(9-6-10-19(17,2)16(22)23)14(20)11-18-15(21)24-12-13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3,(H-,18,21,22,23)/p+1/t17-,19?/m1/s1 |
| InChIKey | HGBJTAOAIMXUMA-DUSLRRAJSA-O |
| XLogP | 2.16 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|