C21H23NO4 — CID 175092778
methyl (2R)-1-(2-phenylacetyl)-2-phenylmethoxypyrrolidine-2-carboxylate (PubChem CID 175092778) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl (2R)-1-(2-phenylacetyl)-2-phenylmethoxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(2-phenylacetyl)-2-phenylmethoxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175092778 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl (2R)-1-(2-phenylacetyl)-2-phenylmethoxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@]1(OCc2ccccc2)CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-25-20(24)21(26-16-18-11-6-3-7-12-18)13-8-14-22(21)19(23)15-17-9-4-2-5-10-17/h2-7,9-12H,8,13-16H2,1H3/t21-/m1/s1 |
| InChIKey | SOQQHGOLNWKCAC-OAQYLSRUSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |