C11H22O2 — CID 155778289
(Z)-2,6-dimethylnon-4-ene-3,4-diol (PubChem CID 155778289) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (Z)-2,6-dimethylnon-4-ene-3,4-diol.
| Compound Name | (Z)-2,6-dimethylnon-4-ene-3,4-diol |
|---|---|
| PubChem CID | 155778289 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (Z)-2,6-dimethylnon-4-ene-3,4-diol |
| SMILES | CCCC(C)/C=C(\O)C(O)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-5-6-9(4)7-10(12)11(13)8(2)3/h7-9,11-13H,5-6H2,1-4H3/b10-7- |
| InChIKey | LAZKRSRJXWDRAD-YFHOEESVSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|