4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid

C19H15NO3S — CID 155782183

IUPAC4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid
SMILESO=C(O)CCC(=O)n1c2c(c3ccccc31)CSc1ccccc1-2
InChIInChI=1S/C19H15NO3S/c21-17(9-10-18(22)23)20-15-7-3-1-5-12(15)14-11-24-16-8-4-2-6-13(16)19(14)20/h1-8H,9-11H2,(H,22,23)
InChIKeyVZFINWMZJLDMCU-UHFFFAOYSA-N
MW337.40 g/mol
LogP4.42
Rot. Bonds3

About 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid

4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid (PubChem CID 155782183) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid.

Molecular Properties

Compound Name4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid
PubChem CID155782183
Molecular FormulaC19H15NO3S
Molecular Weight337.40 g/mol
Exact Mass337.08
IUPAC Name4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid
SMILESO=C(O)CCC(=O)n1c2c(c3ccccc31)CSc1ccccc1-2
InChIInChI=1S/C19H15NO3S/c21-17(9-10-18(22)23)20-15-7-3-1-5-12(15)14-11-24-16-8-4-2-6-13(16)19(14)20/h1-8H,9-11H2,(H,22,23)
InChIKeyVZFINWMZJLDMCU-UHFFFAOYSA-N
XLogP4.42
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.40
LogP ≤ 54.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid?
The IUPAC name of 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid (CID 155782183) is 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid.
What is the SMILES notation for 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid?
The canonical SMILES for 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid is O=C(O)CCC(=O)n1c2c(c3ccccc31)CSc1ccccc1-2.
What is the InChIKey of 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid?
The InChIKey is VZFINWMZJLDMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3S/c21-17(9-10-18(22)23)20-15-7-3-1-5-12(15)14-11-24-16-8-4-2-6-13(16)19(14)20/h1-8H,9-11H2,(H,22,23).
What are the key properties of 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid?
4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid has a molecular weight of 337.40 g/mol, XLogP of 4.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-(6H-thiochromeno[4,3-b]indol-11-yl)butanoic acid is sourced from PubChem (CID 155782183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).