C19H18ClNS — CID 86076241
12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole (PubChem CID 86076241) has the molecular formula C19H18ClNS and a molecular weight of 327.88 g/mol. Its IUPAC name is 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole.
| Compound Name | 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole |
|---|---|
| PubChem CID | 86076241 |
| Molecular Formula | C19H18ClNS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole |
| SMILES | ClCCCn1c2c(c3ccccc31)CCSc1ccccc1-2 |
| InChI | InChI=1S/C19H18ClNS/c20-11-5-12-21-17-8-3-1-6-14(17)15-10-13-22-18-9-4-2-7-16(18)19(15)21/h1-4,6-9H,5,10-13H2 |
| InChIKey | FWCHUHJIFKBCTN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|