About 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole
12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole (PubChem CID 86076241) has the molecular formula C19H18ClNS
and a molecular weight of 327.88 g/mol. Its IUPAC name is 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole.
Molecular Properties
| Compound Name | 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole |
| PubChem CID | 86076241 |
| Molecular Formula | C19H18ClNS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole |
| SMILES | ClCCCn1c2c(c3ccccc31)CCSc1ccccc1-2 |
| InChI | InChI=1S/C19H18ClNS/c20-11-5-12-21-17-8-3-1-6-14(17)15-10-13-22-18-9-4-2-7-16(18)19(15)21/h1-4,6-9H,5,10-13H2 |
| InChIKey | FWCHUHJIFKBCTN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole?
The IUPAC name of 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole (CID 86076241) is 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole.
What is the SMILES notation for 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole?
The canonical SMILES for 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole is ClCCCn1c2c(c3ccccc31)CCSc1ccccc1-2.
What is the InChIKey of 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole?
The InChIKey is FWCHUHJIFKBCTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNS/c20-11-5-12-21-17-8-3-1-6-14(17)15-10-13-22-18-9-4-2-7-16(18)19(15)21/h1-4,6-9H,5,10-13H2.
What are the key properties of 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole?
12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole has a molecular weight of 327.88 g/mol, XLogP of 5.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(3-chloropropyl)-6,7-dihydro-[1]benzothiepino[5,4-b]indole is sourced from PubChem (CID 86076241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).