C29H41NO7P2S — CID 44579676
1,1-bis(diethoxyphosphoryl)-5-(6,7-dihydro-[1]benzothiepino[5,4-b]indol-12-yl)pentan-1-ol (PubChem CID 44579676) has the molecular formula C29H41NO7P2S and a molecular weight of 609.66 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)-5-(6,7-dihydro-[1]benzothiepino[5,4-b]indol-12-yl)pentan-1-ol.
| Compound Name | 1,1-bis(diethoxyphosphoryl)-5-(6,7-dihydro-[1]benzothiepino[5,4-b]indol-12-yl)pentan-1-ol |
|---|---|
| PubChem CID | 44579676 |
| Molecular Formula | C29H41NO7P2S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-5-(6,7-dihydro-[1]benzothiepino[5,4-b]indol-12-yl)pentan-1-ol |
| SMILES | CCOP(=O)(OCC)C(O)(CCCCn1c2c(c3ccccc31)CCSc1ccccc1-2)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H41NO7P2S/c1-5-34-38(32,35-6-2)29(31,39(33,36-7-3)37-8-4)20-13-14-21-30-26-17-11-9-15-23(26)24-19-22-40-27-18-12-10-16-25(27)28(24)30/h9-12,15-18,31H,5-8,13-14,19-22H2,1-4H3 |
| InChIKey | GEVKGMGNENOVBG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|