C19H20N2OS — CID 11638405
11-[2-(dimethylamino)ethyl]-6H-thiochromeno[4,3-b]indol-8-ol (PubChem CID 11638405) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 11-[2-(dimethylamino)ethyl]-6H-thiochromeno[4,3-b]indol-8-ol.
| Compound Name | 11-[2-(dimethylamino)ethyl]-6H-thiochromeno[4,3-b]indol-8-ol |
|---|---|
| PubChem CID | 11638405 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 11-[2-(dimethylamino)ethyl]-6H-thiochromeno[4,3-b]indol-8-ol |
| SMILES | CN(C)CCn1c2c(c3cc(O)ccc31)CSc1ccccc1-2 |
| InChI | InChI=1S/C19H20N2OS/c1-20(2)9-10-21-17-8-7-13(22)11-15(17)16-12-23-18-6-4-3-5-14(18)19(16)21/h3-8,11,22H,9-10,12H2,1-2H3 |
| InChIKey | BHTFXQLLSZJHDX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |