C33H38N2O3S — CID 59676047
[11-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6H-thiochromeno[4,3-b]indol-8-yl] 2,2-dimethylpropanoate (PubChem CID 59676047) has the molecular formula C33H38N2O3S and a molecular weight of 542.75 g/mol. Its IUPAC name is [11-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6H-thiochromeno[4,3-b]indol-8-yl] 2,2-dimethylpropanoate.
| Compound Name | [11-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6H-thiochromeno[4,3-b]indol-8-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59676047 |
| Molecular Formula | C33H38N2O3S |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | [11-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6H-thiochromeno[4,3-b]indol-8-yl] 2,2-dimethylpropanoate |
| SMILES | CCN(CC)CCOc1ccc(Cn2c3c(c4cc(OC(=O)C(C)(C)C)ccc42)CSc2ccccc2-3)cc1 |
| InChI | InChI=1S/C33H38N2O3S/c1-6-34(7-2)18-19-37-24-14-12-23(13-15-24)21-35-29-17-16-25(38-32(36)33(3,4)5)20-27(29)28-22-39-30-11-9-8-10-26(30)31(28)35/h8-17,20H,6-7,18-19,21-22H2,1-5H3 |
| InChIKey | HYASDAOTJLJWKL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|