C21H26ClN5O3 — CID 19976980
[4-[2-[[4-(2-aminoethoxy)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate;hydrochloride (PubChem CID 19976980) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is [4-[2-[[4-(2-aminoethoxy)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate;hydrochloride.
| Compound Name | [4-[2-[[4-(2-aminoethoxy)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 19976980 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [4-[2-[[4-(2-aminoethoxy)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate;hydrochloride |
| SMILES | CC(C)(C)C(=O)Oc1ccc(-c2nnn(Cc3ccc(OCCN)cc3)n2)cc1.Cl |
| InChI | InChI=1S/C21H25N5O3.ClH/c1-21(2,3)20(27)29-18-10-6-16(7-11-18)19-23-25-26(24-19)14-15-4-8-17(9-5-15)28-13-12-22;/h4-11H,12-14,22H2,1-3H3;1H |
| InChIKey | GLADGIJSOACTCU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|