C25H29N5O5S — CID 67708598
(2S)-2-[[4-[[5-[4-(2,2-dimethylpropanoyloxy)phenyl]tetrazol-2-yl]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 67708598) has the molecular formula C25H29N5O5S and a molecular weight of 511.60 g/mol. Its IUPAC name is (2S)-2-[[4-[[5-[4-(2,2-dimethylpropanoyloxy)phenyl]tetrazol-2-yl]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[5-[4-(2,2-dimethylpropanoyloxy)phenyl]tetrazol-2-yl]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 67708598 |
| Molecular Formula | C25H29N5O5S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (2S)-2-[[4-[[5-[4-(2,2-dimethylpropanoyloxy)phenyl]tetrazol-2-yl]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(Cn2nnc(-c3ccc(OC(=O)C(C)(C)C)cc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C25H29N5O5S/c1-25(2,3)24(34)35-19-11-9-17(10-12-19)21-27-29-30(28-21)15-16-5-7-18(8-6-16)22(31)26-20(23(32)33)13-14-36-4/h5-12,20H,13-15H2,1-4H3,(H,26,31)(H,32,33)/t20-/m0/s1 |
| InChIKey | TZJQTNPDQDFTPS-FQEVSTJZSA-N |
| XLogP | 3.28 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'misc_aminoacid_A(1)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|