C23H29N5O2 — CID 19977006
[4-[2-[[4-(butan-2-ylamino)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 19977006) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is [4-[2-[[4-(butan-2-ylamino)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-[[4-(butan-2-ylamino)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 19977006 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [4-[2-[[4-(butan-2-ylamino)phenyl]methyl]tetrazol-5-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCC(C)Nc1ccc(Cn2nnc(-c3ccc(OC(=O)C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H29N5O2/c1-6-16(2)24-19-11-7-17(8-12-19)15-28-26-21(25-27-28)18-9-13-20(14-10-18)30-22(29)23(3,4)5/h7-14,16,24H,6,15H2,1-5H3 |
| InChIKey | BZMBRUJUACLYHM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|