C17H21N5O2S — CID 155784076
(9aS)-8-(5-cyclohexyl-1,3-thiazol-2-yl)-4,9-dioxo-3,6,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonitrile (PubChem CID 155784076) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is (9aS)-8-(5-cyclohexyl-1,3-thiazol-2-yl)-4,9-dioxo-3,6,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonitrile.
| Compound Name | (9aS)-8-(5-cyclohexyl-1,3-thiazol-2-yl)-4,9-dioxo-3,6,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155784076 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (9aS)-8-(5-cyclohexyl-1,3-thiazol-2-yl)-4,9-dioxo-3,6,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carbonitrile |
| SMILES | N#CN1CC(=O)N2CCN(c3ncc(C4CCCCC4)s3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H21N5O2S/c18-11-20-9-13-16(24)22(7-6-21(13)15(23)10-20)17-19-8-14(25-17)12-4-2-1-3-5-12/h8,12-13H,1-7,9-10H2/t13-/m0/s1 |
| InChIKey | XDAQJDPNPJRDGM-ZDUSSCGKSA-N |
| XLogP | 1.53 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|