C17H22FN5OS — CID 156534622
2-(2-cyclohexyl-4-fluoro-1,3-thiazol-5-yl)-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 156534622) has the molecular formula C17H22FN5OS and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(2-cyclohexyl-4-fluoro-1,3-thiazol-5-yl)-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | 2-(2-cyclohexyl-4-fluoro-1,3-thiazol-5-yl)-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 156534622 |
| Molecular Formula | C17H22FN5OS |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-(2-cyclohexyl-4-fluoro-1,3-thiazol-5-yl)-1-oxo-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#CN1CCN2CCN(c3sc(C4CCCCC4)nc3F)C(=O)C2C1 |
| InChI | InChI=1S/C17H22FN5OS/c18-14-17(25-15(20-14)12-4-2-1-3-5-12)23-9-8-22-7-6-21(11-19)10-13(22)16(23)24/h12-13H,1-10H2 |
| InChIKey | FMVUCYYQFVNCKE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|