About CID 155784891
CID 155784891 (PubChem CID 155784891) has the molecular formula C60H34B2N6O5Pt2-2
and a molecular weight of 1330.75 g/mol.
Molecular Properties
| Compound Name | CID 155784891 |
| PubChem CID | 155784891 |
| Molecular Formula | C60H34B2N6O5Pt2-2 |
| Molecular Weight | 1330.75 g/mol |
| Exact Mass | 1330.21 |
| IUPAC Name | — |
| SMILES | Cc1nn(-c2[c-]c3c(nc2)Oc2cccc4c2B3c2[c-]c(-c3[c-]c(-c5[c-]c6c(cc5)Oc5cccc7c5B6c5[c-]c(-n6[c-][n+](C)c(-c8ccccc8)c6C)cnc5O7)[c-]o3)ccc2O4)c(C)c1-c1ccccc1.[Pt+4].[Pt] |
| InChI | InChI=1S/C60H34B2N6O5.2Pt/c1-34-55(37-13-7-5-8-14-37)35(2)68(65-34)43-29-47-60(64-31-43)73-53-20-12-18-51-57(53)62(47)45-26-40(22-24-49(45)71-51)54-27-41(32-69-54)39-21-23-48-44(25-39)61-46-28-42(30-63-59(46)72-52-19-11-17-50(70-48)56(52)61)67-33-66(4)58(36(67)3)38-15-9-6-10-16-38;;/h5-24,30-31H,1-4H3;;/q-6;;+4 |
| InChIKey | MYGJMNKXDYJRGC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 102.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1330.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 155784891 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155784891?
The IUPAC name of CID 155784891 (CID 155784891) is not available.
What is the SMILES notation for CID 155784891?
The canonical SMILES for CID 155784891 is Cc1nn(-c2[c-]c3c(nc2)Oc2cccc4c2B3c2[c-]c(-c3[c-]c(-c5[c-]c6c(cc5)Oc5cccc7c5B6c5[c-]c(-n6[c-][n+](C)c(-c8ccccc8)c6C)cnc5O7)[c-]o3)ccc2O4)c(C)c1-c1ccccc1.[Pt+4].[Pt].
What is the InChIKey of CID 155784891?
The InChIKey is MYGJMNKXDYJRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H34B2N6O5.2Pt/c1-34-55(37-13-7-5-8-14-37)35(2)68(65-34)43-29-47-60(64-31-43)73-53-20-12-18-51-57(53)62(47)45-26-40(22-24-49(45)71-51)54-27-41(32-69-54)39-21-23-48-44(25-39)61-46-28-42(30-63-59(46)72-52-19-11-17-50(70-48)56(52)61)67-33-66(4)58(36(67)3)38-15-9-6-10-16-38;;/h5-24,30-31H,1-4H3;;/q-6;;+4.
What are the key properties of CID 155784891?
CID 155784891 has a molecular weight of 1330.75 g/mol, XLogP of 7.52, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155784891 is sourced from PubChem (CID 155784891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).