About CID 155784861
CID 155784861 (PubChem CID 155784861) has the molecular formula C56H28B2N4O5Pt2+2
and a molecular weight of 1248.64 g/mol.
Molecular Properties
| Compound Name | CID 155784861 |
| PubChem CID | 155784861 |
| Molecular Formula | C56H28B2N4O5Pt2+2 |
| Molecular Weight | 1248.64 g/mol |
| Exact Mass | 1248.15 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n(-c2[c-]c3c(cc2)Oc2cccc4c2B3c2[c-]c(-c3[c-]oc(-c5[c-]c6c(cc5)Oc5cccc7c5B6c5[c-]c(-n6[c-][n+](C)c8ccccc86)ccc5O7)[c-]3)ccc2O4)c2ccccc21.[Pt+4].[Pt+4] |
| InChI | InChI=1S/C56H28B2N4O5.2Pt/c1-59-31-61(44-11-5-3-9-42(44)59)36-19-23-48-40(28-36)57-38-25-33(17-21-46(38)64-50-13-7-15-52(66-48)55(50)57)35-27-54(63-30-35)34-18-22-47-39(26-34)58-41-29-37(62-32-60(2)43-10-4-6-12-45(43)62)20-24-49(41)67-53-16-8-14-51(65-47)56(53)58;;/h3-24H,1-2H3;;/q-6;2*+4 |
| InChIKey | CWYMHGOHZGVXKW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1248.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 155784861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155784861?
The IUPAC name of CID 155784861 (CID 155784861) is not available.
What is the SMILES notation for CID 155784861?
The canonical SMILES for CID 155784861 is C[n+]1[c-]n(-c2[c-]c3c(cc2)Oc2cccc4c2B3c2[c-]c(-c3[c-]oc(-c5[c-]c6c(cc5)Oc5cccc7c5B6c5[c-]c(-n6[c-][n+](C)c8ccccc86)ccc5O7)[c-]3)ccc2O4)c2ccccc21.[Pt+4].[Pt+4].
What is the InChIKey of CID 155784861?
The InChIKey is CWYMHGOHZGVXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H28B2N4O5.2Pt/c1-59-31-61(44-11-5-3-9-42(44)59)36-19-23-48-40(28-36)57-38-25-33(17-21-46(38)64-50-13-7-15-52(66-48)55(50)57)35-27-54(63-30-35)34-18-22-47-39(26-34)58-41-29-37(62-32-60(2)43-10-4-6-12-45(43)62)20-24-49(41)67-53-16-8-14-51(65-47)56(53)58;;/h3-24H,1-2H3;;/q-6;2*+4.
What are the key properties of CID 155784861?
CID 155784861 has a molecular weight of 1248.64 g/mol, XLogP of 6.00, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155784861 is sourced from PubChem (CID 155784861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).