About CID 155784848
CID 155784848 (PubChem CID 155784848) has the molecular formula C57H29B2N7O4Pt2-6
and a molecular weight of 1287.68 g/mol.
Molecular Properties
| Compound Name | CID 155784848 |
| PubChem CID | 155784848 |
| Molecular Formula | C57H29B2N7O4Pt2-6 |
| Molecular Weight | 1287.68 g/mol |
| Exact Mass | 1287.18 |
| IUPAC Name | — |
| SMILES | Cn1[c-]c(-c2[c-]c3c(cc2)Oc2cccc4c2B3c2[c-]c(-n3cc(-c5ccccc5)cn3)cnc2O4)[c-]c1-c1[c-]c2c(cc1)Oc1cccc3c1B2c1[c-]c(-n2cc(-c4ccccc4)cn2)cnc1O3.[Pt].[Pt] |
| InChI | InChI=1S/C57H29B2N7O4.2Pt/c1-64-31-38(36-18-20-48-43(22-36)58-45-25-41(65-32-39(27-62-65)34-10-4-2-5-11-34)29-60-56(45)69-52-16-8-14-50(67-48)54(52)58)24-47(64)37-19-21-49-44(23-37)59-46-26-42(66-33-40(28-63-66)35-12-6-3-7-13-35)30-61-57(46)70-53-17-9-15-51(68-49)55(53)59;;/h2-21,27-30,32-33H,1H3;;/q-6;; |
| InChIKey | MRHWDMNRIAYIIQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 103.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1287.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155784848 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155784848?
The IUPAC name of CID 155784848 (CID 155784848) is not available.
What is the SMILES notation for CID 155784848?
The canonical SMILES for CID 155784848 is Cn1[c-]c(-c2[c-]c3c(cc2)Oc2cccc4c2B3c2[c-]c(-n3cc(-c5ccccc5)cn3)cnc2O4)[c-]c1-c1[c-]c2c(cc1)Oc1cccc3c1B2c1[c-]c(-n2cc(-c4ccccc4)cn2)cnc1O3.[Pt].[Pt].
What is the InChIKey of CID 155784848?
The InChIKey is MRHWDMNRIAYIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H29B2N7O4.2Pt/c1-64-31-38(36-18-20-48-43(22-36)58-45-25-41(65-32-39(27-62-65)34-10-4-2-5-11-34)29-60-56(45)69-52-16-8-14-50(67-48)54(52)58)24-47(64)37-19-21-49-44(23-37)59-46-26-42(66-33-40(28-63-66)35-12-6-3-7-13-35)30-61-57(46)70-53-17-9-15-51(68-49)55(53)59;;/h2-21,27-30,32-33H,1H3;;/q-6;;.
What are the key properties of CID 155784848?
CID 155784848 has a molecular weight of 1287.68 g/mol, XLogP of 7.11, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155784848 is sourced from PubChem (CID 155784848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).