C13H20ClN — CID 155787493
4,5-ditert-butyl-2-chloropyridine (PubChem CID 155787493) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-chloropyridine.
| Compound Name | 4,5-ditert-butyl-2-chloropyridine |
|---|---|
| PubChem CID | 155787493 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4,5-ditert-butyl-2-chloropyridine |
| SMILES | CC(C)(C)c1cnc(Cl)cc1C(C)(C)C |
| InChI | InChI=1S/C13H20ClN/c1-12(2,3)9-7-11(14)15-8-10(9)13(4,5)6/h7-8H,1-6H3 |
| InChIKey | VMRKOXPDBYBWHH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|