C17H27N — CID 159932847
4,5-ditert-butyl-2-(2-methylprop-2-enyl)pyridine (PubChem CID 159932847) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-(2-methylprop-2-enyl)pyridine.
| Compound Name | 4,5-ditert-butyl-2-(2-methylprop-2-enyl)pyridine |
|---|---|
| PubChem CID | 159932847 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4,5-ditert-butyl-2-(2-methylprop-2-enyl)pyridine |
| SMILES | C=C(C)Cc1cc(C(C)(C)C)c(C(C)(C)C)cn1 |
| InChI | InChI=1S/C17H27N/c1-12(2)9-13-10-14(16(3,4)5)15(11-18-13)17(6,7)8/h10-11H,1,9H2,2-8H3 |
| InChIKey | AMWZMPZJFYHDNJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|