C16H17ClF3NO2 — CID 163806676
(3E)-3-chloro-5-hydroxy-4-methyl-6-[[5-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]hepta-3,6-dien-2-one (PubChem CID 163806676) has the molecular formula C16H17ClF3NO2 and a molecular weight of 347.76 g/mol. Its IUPAC name is (3E)-3-chloro-5-hydroxy-4-methyl-6-[[5-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]hepta-3,6-dien-2-one.
| Compound Name | (3E)-3-chloro-5-hydroxy-4-methyl-6-[[5-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]hepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 163806676 |
| Molecular Formula | C16H17ClF3NO2 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (3E)-3-chloro-5-hydroxy-4-methyl-6-[[5-methyl-4-(trifluoromethyl)-2-pyridinyl]methyl]hepta-3,6-dien-2-one |
| SMILES | C=C(Cc1cc(C(F)(F)F)c(C)cn1)C(O)/C(C)=C(/Cl)C(C)=O |
| InChI | InChI=1S/C16H17ClF3NO2/c1-8(15(23)10(3)14(17)11(4)22)5-12-6-13(16(18,19)20)9(2)7-21-12/h6-7,15,23H,1,5H2,2-4H3/b14-10+ |
| InChIKey | NJPRVISOKQYERH-GXDHUFHOSA-N |
| XLogP | 3.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|