carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine

C8H5ClF3NO2 — CID 161141422

IUPACcarbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine
SMILESCc1cnc(Cl)cc1C(F)(F)F.O=C=O
InChIInChI=1S/C7H5ClF3N.CO2/c1-4-3-12-6(8)2-5(4)7(9,10)11;2-1-3/h2-3H,1H3;
InChIKeyUNMNPTCPZDHFIP-UHFFFAOYSA-N
MW239.58 g/mol
LogP2.48
Rot. Bonds

About carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine

carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine (PubChem CID 161141422) has the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. Its IUPAC name is carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine.

Molecular Properties

Compound Namecarbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine
PubChem CID161141422
Molecular FormulaC8H5ClF3NO2
Molecular Weight239.58 g/mol
Exact Mass239.00
IUPAC Namecarbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine
SMILESCc1cnc(Cl)cc1C(F)(F)F.O=C=O
InChIInChI=1S/C7H5ClF3N.CO2/c1-4-3-12-6(8)2-5(4)7(9,10)11;2-1-3/h2-3H,1H3;
InChIKeyUNMNPTCPZDHFIP-UHFFFAOYSA-N
XLogP2.48
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.58
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine?
The IUPAC name of carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine (CID 161141422) is carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine.
What is the SMILES notation for carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine?
The canonical SMILES for carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine is Cc1cnc(Cl)cc1C(F)(F)F.O=C=O.
What is the InChIKey of carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine?
The InChIKey is UNMNPTCPZDHFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF3N.CO2/c1-4-3-12-6(8)2-5(4)7(9,10)11;2-1-3/h2-3H,1H3;.
What are the key properties of carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine?
carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine has a molecular weight of 239.58 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-chloro-5-methyl-4-(trifluoromethyl)pyridine is sourced from PubChem (CID 161141422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).