C23H22N4O6 — CID 155791973
2-[4-[7-(2-hydroxyethoxycarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 155791973) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2-[4-[7-(2-hydroxyethoxycarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-[4-[7-(2-hydroxyethoxycarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155791973 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[4-[7-(2-hydroxyethoxycarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)CC1c1ccc(Oc2ccnc3cc(C(=O)NOCCO)ccc23)cc1 |
| InChI | InChI=1S/C23H22N4O6/c24-21(30)23(22(25)31)12-17(23)13-1-4-15(5-2-13)33-19-7-8-26-18-11-14(3-6-16(18)19)20(29)27-32-10-9-28/h1-8,11,17,28H,9-10,12H2,(H2,24,30)(H2,25,31)(H,27,29) |
| InChIKey | SSZHJVBBJXNSMU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|