C24H19N5O3 — CID 167343268
2-[4-(7-pyrimidin-4-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 167343268) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-[4-(7-pyrimidin-4-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-[4-(7-pyrimidin-4-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 167343268 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[4-(7-pyrimidin-4-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)CC1c1ccc(Oc2ccnc3cc(-c4ccncn4)ccc23)cc1 |
| InChI | InChI=1S/C24H19N5O3/c25-22(30)24(23(26)31)12-18(24)14-1-4-16(5-2-14)32-21-8-10-28-20-11-15(3-6-17(20)21)19-7-9-27-13-29-19/h1-11,13,18H,12H2,(H2,25,30)(H2,26,31) |
| InChIKey | SJWNUMJZCUCHSD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|