C26H19F3N4O3 — CID 167343249
2-[4-[7-[6-(trifluoromethyl)-3-pyridinyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 167343249) has the molecular formula C26H19F3N4O3 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-[4-[7-[6-(trifluoromethyl)-3-pyridinyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-[4-[7-[6-(trifluoromethyl)-3-pyridinyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 167343249 |
| Molecular Formula | C26H19F3N4O3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[4-[7-[6-(trifluoromethyl)-3-pyridinyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)CC1c1ccc(Oc2ccnc3cc(-c4ccc(C(F)(F)F)nc4)ccc23)cc1 |
| InChI | InChI=1S/C26H19F3N4O3/c27-26(28,29)22-8-4-16(13-33-22)15-3-7-18-20(11-15)32-10-9-21(18)36-17-5-1-14(2-6-17)19-12-25(19,23(30)34)24(31)35/h1-11,13,19H,12H2,(H2,30,34)(H2,31,35) |
| InChIKey | RBQOMVIGIPDYPI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|