C26H27N5O5 — CID 155792000
2-[4-[7-methoxy-6-[(1-methylazetidin-3-yl)carbamoyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 155792000) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[4-[7-methoxy-6-[(1-methylazetidin-3-yl)carbamoyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-[4-[7-methoxy-6-[(1-methylazetidin-3-yl)carbamoyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155792000 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[4-[7-methoxy-6-[(1-methylazetidin-3-yl)carbamoyl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(C4CC4(C(N)=O)C(N)=O)cc3)c2cc1C(=O)NC1CN(C)C1 |
| InChI | InChI=1S/C26H27N5O5/c1-31-12-15(13-31)30-23(32)18-9-17-20(10-22(18)35-2)29-8-7-21(17)36-16-5-3-14(4-6-16)19-11-26(19,24(27)33)25(28)34/h3-10,15,19H,11-13H2,1-2H3,(H2,27,33)(H2,28,34)(H,30,32) |
| InChIKey | URMAGPRJQIULHL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|