C18H19CsO3 — CID 155795433
cesium (4R)-4-methyl-2-(4-phenylmethoxyphenoxy)-2,3,4,5-tetrahydrofuran-5-ide (PubChem CID 155795433) has the molecular formula C18H19CsO3 and a molecular weight of 416.25 g/mol. Its IUPAC name is cesium (4R)-4-methyl-2-(4-phenylmethoxyphenoxy)-2,3,4,5-tetrahydrofuran-5-ide.
| Compound Name | cesium (4R)-4-methyl-2-(4-phenylmethoxyphenoxy)-2,3,4,5-tetrahydrofuran-5-ide |
|---|---|
| PubChem CID | 155795433 |
| Molecular Formula | C18H19CsO3 |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | cesium (4R)-4-methyl-2-(4-phenylmethoxyphenoxy)-2,3,4,5-tetrahydrofuran-5-ide |
| SMILES | C[C@H]1[CH-]OC(Oc2ccc(OCc3ccccc3)cc2)C1.[Cs+] |
| InChI | InChI=1S/C18H19O3.Cs/c1-14-11-18(20-12-14)21-17-9-7-16(8-10-17)19-13-15-5-3-2-4-6-15;/h2-10,12,14,18H,11,13H2,1H3;/q-1;+1/t14-,18?;/m1./s1 |
| InChIKey | ARIYKEXKXPQBSN-BSOSYTQUSA-N |
| XLogP | 1.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|