C24H32O10 — CID 155795838
2-O-[2-[2-[3-(2-acetyloxyethoxy)-3-oxopropyl]hexanoyloxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 155795838) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is 2-O-[2-[2-[3-(2-acetyloxyethoxy)-3-oxopropyl]hexanoyloxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[2-[3-(2-acetyloxyethoxy)-3-oxopropyl]hexanoyloxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155795838 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-O-[2-[2-[3-(2-acetyloxyethoxy)-3-oxopropyl]hexanoyloxy]ethyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | CCCCC(CCC(=O)OCCOC(C)=O)C(=O)OCCOC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C24H32O10/c1-4-5-8-18(11-12-21(26)32-14-13-31-17(2)25)22(27)33-15-16-34-24(29)20-10-7-6-9-19(20)23(28)30-3/h6-7,9-10,18H,4-5,8,11-16H2,1-3H3 |
| InChIKey | XXIBCAWXJNVHRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|