C15H16N4O3S — CID 155798491
7-(4-ethoxy-1,3-benzothiazol-2-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 155798491) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 7-(4-ethoxy-1,3-benzothiazol-2-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(4-ethoxy-1,3-benzothiazol-2-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 155798491 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 7-(4-ethoxy-1,3-benzothiazol-2-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCOc1cccc2sc(N3CCC4(C3)NC(=O)NC4=O)nc12 |
| InChI | InChI=1S/C15H16N4O3S/c1-2-22-9-4-3-5-10-11(9)16-14(23-10)19-7-6-15(8-19)12(20)17-13(21)18-15/h3-5H,2,6-8H2,1H3,(H2,17,18,20,21) |
| InChIKey | OIUSVCCECUDRRR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|