C16H12Cl3N3O — CID 15580737
4-chloro-N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]benzamide (PubChem CID 15580737) has the molecular formula C16H12Cl3N3O and a molecular weight of 368.65 g/mol. Its IUPAC name is 4-chloro-N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 15580737 |
| Molecular Formula | C16H12Cl3N3O |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 4-chloro-N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]benzamide |
| SMILES | O=C(NC1=NN(c2ccc(Cl)c(Cl)c2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3N3O/c17-11-3-1-10(2-4-11)16(23)20-15-7-8-22(21-15)12-5-6-13(18)14(19)9-12/h1-6,9H,7-8H2,(H,20,21,23) |
| InChIKey | RWCWVKBJWOVXTR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |