C17H19BCl2N4O4 — CID 177061894
CID 177061894 (PubChem CID 177061894) has the molecular formula C17H19BCl2N4O4 and a molecular weight of 425.08 g/mol.
| Compound Name | CID 177061894 |
|---|---|
| PubChem CID | 177061894 |
| Molecular Formula | C17H19BCl2N4O4 |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | — |
| SMILES | [B]C(=O)COCC(=O)NCCCC(=O)NC1=NN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19BCl2N4O4/c18-14(25)9-28-10-17(27)21-6-1-2-16(26)22-15-5-7-24(23-15)11-3-4-12(19)13(20)8-11/h3-4,8H,1-2,5-7,9-10H2,(H,21,27)(H,22,23,26) |
| InChIKey | MGYNVNGSTGPVNN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|