C17H19Cl2IN4O4 — CID 177062094
2-[2-[[4-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-4-oxobutyl]amino]-2-oxoethoxy]acetyl iodide (PubChem CID 177062094) has the molecular formula C17H19Cl2IN4O4 and a molecular weight of 541.17 g/mol. Its IUPAC name is 2-[2-[[4-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-4-oxobutyl]amino]-2-oxoethoxy]acetyl iodide.
| Compound Name | 2-[2-[[4-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-4-oxobutyl]amino]-2-oxoethoxy]acetyl iodide |
|---|---|
| PubChem CID | 177062094 |
| Molecular Formula | C17H19Cl2IN4O4 |
| Molecular Weight | 541.17 g/mol |
| Exact Mass | 539.98 |
| IUPAC Name | 2-[2-[[4-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-4-oxobutyl]amino]-2-oxoethoxy]acetyl iodide |
| SMILES | O=C(I)COCC(=O)NCCCC(=O)NC1=NN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19Cl2IN4O4/c18-12-4-3-11(8-13(12)19)24-7-5-15(23-24)22-16(26)2-1-6-21-17(27)10-28-9-14(20)25/h3-4,8H,1-2,5-7,9-10H2,(H,21,27)(H,22,23,26) |
| InChIKey | JRLRKZRGCVHWPC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|