C28H42BCl2N7O3 — CID 177061767
CID 177061767 (PubChem CID 177061767) has the molecular formula C28H42BCl2N7O3 and a molecular weight of 606.41 g/mol.
| Compound Name | CID 177061767 |
|---|---|
| PubChem CID | 177061767 |
| Molecular Formula | C28H42BCl2N7O3 |
| Molecular Weight | 606.41 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(CN2CCN(CCOCC(=O)NCCCC(=O)NC3=NN(c4ccc(Cl)c(Cl)c4)CC3C)CC2)CC1 |
| InChI | InChI=1S/C28H42BCl2N7O3/c1-21-18-38(23-4-5-24(30)25(31)17-23)34-28(21)33-26(39)3-2-8-32-27(40)20-41-16-15-35-11-13-36(14-12-35)19-22-6-9-37(29)10-7-22/h4-5,17,21-22H,2-3,6-16,18-20H2,1H3,(H,32,40)(H,33,34,39) |
| InChIKey | FGWXJJZOGLKORK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|