C20H29Cl2N5O4 — CID 177062382
4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]butanamide (PubChem CID 177062382) has the molecular formula C20H29Cl2N5O4 and a molecular weight of 474.39 g/mol. Its IUPAC name is 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]butanamide.
| Compound Name | 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]butanamide |
|---|---|
| PubChem CID | 177062382 |
| Molecular Formula | C20H29Cl2N5O4 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]butanamide |
| SMILES | CC1CN(c2ccc(Cl)c(Cl)c2)N=C1NC(=O)CCCNC(=O)COCCOCCN |
| InChI | InChI=1S/C20H29Cl2N5O4/c1-14-12-27(15-4-5-16(21)17(22)11-15)26-20(14)25-18(28)3-2-7-24-19(29)13-31-10-9-30-8-6-23/h4-5,11,14H,2-3,6-10,12-13,23H2,1H3,(H,24,29)(H,25,26,28) |
| InChIKey | HWKCKIPAQCSFMU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|