C19H25Cl2N3O6 — CID 177062058
3-[2-[2-[3-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 177062058) has the molecular formula C19H25Cl2N3O6 and a molecular weight of 462.33 g/mol. Its IUPAC name is 3-[2-[2-[3-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[3-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 177062058 |
| Molecular Formula | C19H25Cl2N3O6 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-[2-[2-[3-[[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCC(=O)NC1=NN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H25Cl2N3O6/c20-15-2-1-14(13-16(15)21)24-6-3-17(23-24)22-18(25)4-7-28-9-11-30-12-10-29-8-5-19(26)27/h1-2,13H,3-12H2,(H,26,27)(H,22,23,25) |
| InChIKey | WEFXZESFFIXUEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|