C17H23Cl2N3O — CID 177135458
N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]-5-methylheptanamide (PubChem CID 177135458) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]-5-methylheptanamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]-5-methylheptanamide |
|---|---|
| PubChem CID | 177135458 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]-5-methylheptanamide |
| SMILES | CCC(C)CCCC(=O)NC1=NN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O/c1-3-12(2)5-4-6-17(23)20-16-9-10-22(21-16)13-7-8-14(18)15(19)11-13/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,20,21,23) |
| InChIKey | LUCIWDINTZFHQH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |