C24H36BCl2N3O6 — CID 177062228
CID 177062228 (PubChem CID 177062228) has the molecular formula C24H36BCl2N3O6 and a molecular weight of 544.29 g/mol.
| Compound Name | CID 177062228 |
|---|---|
| PubChem CID | 177062228 |
| Molecular Formula | C24H36BCl2N3O6 |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | — |
| SMILES | CC.[B]C(=O)CCOCCOCCOCCOCCC(=O)NC1=NN(c2ccc(Cl)c(Cl)c2)CC1C |
| InChI | InChI=1S/C22H30BCl2N3O6.C2H6/c1-16-15-28(17-2-3-18(24)19(25)14-17)27-22(16)26-21(30)5-7-32-9-11-34-13-12-33-10-8-31-6-4-20(23)29;1-2/h2-3,14,16H,4-13,15H2,1H3,(H,26,27,30);1-2H3 |
| InChIKey | CJOPSSCKEBRVMC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|