C28H42Cl2IN7O3 — CID 177062039
N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]-4-[[2-[2-[4-[(4-iodopiperazin-1-yl)methyl]piperidin-1-yl]ethoxy]acetyl]amino]butanamide (PubChem CID 177062039) has the molecular formula C28H42Cl2IN7O3 and a molecular weight of 722.50 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]-4-[[2-[2-[4-[(4-iodopiperazin-1-yl)methyl]piperidin-1-yl]ethoxy]acetyl]amino]butanamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]-4-[[2-[2-[4-[(4-iodopiperazin-1-yl)methyl]piperidin-1-yl]ethoxy]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 177062039 |
| Molecular Formula | C28H42Cl2IN7O3 |
| Molecular Weight | 722.50 g/mol |
| Exact Mass | 721.18 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazol-5-yl]-4-[[2-[2-[4-[(4-iodopiperazin-1-yl)methyl]piperidin-1-yl]ethoxy]acetyl]amino]butanamide |
| SMILES | CC1CN(c2ccc(Cl)c(Cl)c2)N=C1NC(=O)CCCNC(=O)COCCN1CCC(CN2CCN(I)CC2)CC1 |
| InChI | InChI=1S/C28H42Cl2IN7O3/c1-21-18-38(23-4-5-24(29)25(30)17-23)34-28(21)33-26(39)3-2-8-32-27(40)20-41-16-15-35-9-6-22(7-10-35)19-36-11-13-37(31)14-12-36/h4-5,17,21-22H,2-3,6-16,18-20H2,1H3,(H,32,40)(H,33,34,39) |
| InChIKey | WVGBUOACAQKTHC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|