C14H9N3O — CID 155808210
1,8,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaen-9-one (PubChem CID 155808210) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is 1,8,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaen-9-one.
| Compound Name | 1,8,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 155808210 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1,8,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaen-9-one |
| SMILES | O=c1[nH]c2ccccc2n2cc3ncccc3c12 |
| InChI | InChI=1S/C14H9N3O/c18-14-13-9-4-3-7-15-11(9)8-17(13)12-6-2-1-5-10(12)16-14/h1-8H,(H,16,18) |
| InChIKey | FWKAZVMBFVSXAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |